About 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one
3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one (PubChem CID 102474039) has the molecular formula C17H14N2O3
and a molecular weight of 294.31 g/mol. Its IUPAC name is 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one.
Molecular Properties
| Compound Name | 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one |
| PubChem CID | 102474039 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one |
| SMILES | O=C1OCC2(CC(c3ccccc3)=NO2)N1c1ccccc1 |
| InChI | InChI=1S/C17H14N2O3/c20-16-19(14-9-5-2-6-10-14)17(12-21-16)11-15(18-22-17)13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | MCMPZXIOKOIQLC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one?
The IUPAC name of 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one (CID 102474039) is 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one.
What is the SMILES notation for 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one?
The canonical SMILES for 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one is O=C1OCC2(CC(c3ccccc3)=NO2)N1c1ccccc1.
What is the InChIKey of 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one?
The InChIKey is MCMPZXIOKOIQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3/c20-16-19(14-9-5-2-6-10-14)17(12-21-16)11-15(18-22-17)13-7-3-1-4-8-13/h1-10H,11-12H2.
What are the key properties of 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one?
3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one has a molecular weight of 294.31 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diphenyl-1,8-dioxa-2,6-diazaspiro[4.4]non-2-en-7-one is sourced from PubChem (CID 102474039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).