C43H32F6N2O4 — CID 102474108
3-[4-[4-[2-[4-[4-(2,4-dihydro-1,3-benzoxazin-3-yl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 102474108) has the molecular formula C43H32F6N2O4 and a molecular weight of 754.73 g/mol. Its IUPAC name is 3-[4-[4-[2-[4-[4-(2,4-dihydro-1,3-benzoxazin-3-yl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-[4-[4-[2-[4-[4-(2,4-dihydro-1,3-benzoxazin-3-yl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 102474108 |
| Molecular Formula | C43H32F6N2O4 |
| Molecular Weight | 754.73 g/mol |
| Exact Mass | 754.23 |
| IUPAC Name | 3-[4-[4-[2-[4-[4-(2,4-dihydro-1,3-benzoxazin-3-yl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | FC(F)(F)C(c1ccc(Oc2ccc(N3COc4ccccc4C3)cc2)cc1)(c1ccc(Oc2ccc(N3COc4ccccc4C3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C43H32F6N2O4/c44-42(45,46)41(43(47,48)49,31-9-17-35(18-10-31)54-37-21-13-33(14-22-37)50-25-29-5-1-3-7-39(29)52-27-50)32-11-19-36(20-12-32)55-38-23-15-34(16-24-38)51-26-30-6-2-4-8-40(30)53-28-51/h1-24H,25-28H2 |
| InChIKey | AQBCASHUWMEABT-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.73 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |