C22H19FO3S — CID 102474227
(E)-1-(benzenesulfonyl)-1-fluoro-2,4-diphenylbut-3-en-2-ol (PubChem CID 102474227) has the molecular formula C22H19FO3S and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-1-(benzenesulfonyl)-1-fluoro-2,4-diphenylbut-3-en-2-ol.
| Compound Name | (E)-1-(benzenesulfonyl)-1-fluoro-2,4-diphenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 102474227 |
| Molecular Formula | C22H19FO3S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (E)-1-(benzenesulfonyl)-1-fluoro-2,4-diphenylbut-3-en-2-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)C(O)(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19FO3S/c23-21(27(25,26)20-14-8-3-9-15-20)22(24,19-12-6-2-7-13-19)17-16-18-10-4-1-5-11-18/h1-17,21,24H/b17-16+ |
| InChIKey | IBIHSJJLKRLPLT-WUKNDPDISA-N |
| XLogP | 4.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |