C28H21FO5S2 — CID 102474235
(E)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbut-2-en-1-one (PubChem CID 102474235) has the molecular formula C28H21FO5S2 and a molecular weight of 520.60 g/mol. Its IUPAC name is (E)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbut-2-en-1-one.
| Compound Name | (E)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbut-2-en-1-one |
|---|---|
| PubChem CID | 102474235 |
| Molecular Formula | C28H21FO5S2 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | (E)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbut-2-en-1-one |
| SMILES | O=C(/C=C(\c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H21FO5S2/c29-28(35(31,32)24-17-9-3-10-18-24,36(33,34)25-19-11-4-12-20-25)26(22-13-5-1-6-14-22)21-27(30)23-15-7-2-8-16-23/h1-21H/b26-21+ |
| InChIKey | YACKGFBXCUGZGR-YYADALCUSA-N |
| XLogP | 5.52 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|