C11H15ClO4 — CID 102474410
[(3aS,5R,7aS)-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate (PubChem CID 102474410) has the molecular formula C11H15ClO4 and a molecular weight of 246.69 g/mol. Its IUPAC name is [(3aS,5R,7aS)-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate.
| Compound Name | [(3aS,5R,7aS)-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate |
|---|---|
| PubChem CID | 102474410 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [(3aS,5R,7aS)-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(Cl)[C@H]2OC(C)(C)O[C@H]2C1 |
| InChI | InChI=1S/C11H15ClO4/c1-6(13)14-7-4-8(12)10-9(5-7)15-11(2,3)16-10/h4,7,9-10H,5H2,1-3H3/t7-,9-,10+/m0/s1 |
| InChIKey | XBXSTKQBPBSPLN-UJNFCWOMSA-N |
| XLogP | 1.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |