C11H13NO2 — CID 102474509
(3R,5S)-3,5-bis(ethenyl)-1-prop-2-enoylpyrrolidin-2-one (PubChem CID 102474509) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (3R,5S)-3,5-bis(ethenyl)-1-prop-2-enoylpyrrolidin-2-one.
| Compound Name | (3R,5S)-3,5-bis(ethenyl)-1-prop-2-enoylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102474509 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3R,5S)-3,5-bis(ethenyl)-1-prop-2-enoylpyrrolidin-2-one |
| SMILES | C=CC(=O)N1C(=O)[C@@H](C=C)C[C@H]1C=C |
| InChI | InChI=1S/C11H13NO2/c1-4-8-7-9(5-2)12(11(8)14)10(13)6-3/h4-6,8-9H,1-3,7H2/t8-,9+/m0/s1 |
| InChIKey | XXEYSPZHAWMANX-DTWKUNHWSA-N |
| XLogP | 1.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|