C21H28O3 — CID 102474892
2-methoxy-3,5-dimethyl-6-[(2Z,4Z,6E,8E)-4,6,8-trimethyldeca-2,4,6,8-tetraen-2-yl]pyran-4-one (PubChem CID 102474892) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-methoxy-3,5-dimethyl-6-[(2Z,4Z,6E,8E)-4,6,8-trimethyldeca-2,4,6,8-tetraen-2-yl]pyran-4-one.
| Compound Name | 2-methoxy-3,5-dimethyl-6-[(2Z,4Z,6E,8E)-4,6,8-trimethyldeca-2,4,6,8-tetraen-2-yl]pyran-4-one |
|---|---|
| PubChem CID | 102474892 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-methoxy-3,5-dimethyl-6-[(2Z,4Z,6E,8E)-4,6,8-trimethyldeca-2,4,6,8-tetraen-2-yl]pyran-4-one |
| SMILES | C/C=C(C)/C=C(C)/C=C(C)\C=C(\C)c1oc(OC)c(C)c(=O)c1C |
| InChI | InChI=1S/C21H28O3/c1-9-13(2)10-14(3)11-15(4)12-16(5)20-17(6)19(22)18(7)21(23-8)24-20/h9-12H,1-8H3/b13-9+,14-10+,15-11-,16-12- |
| InChIKey | KRJDRWQBXHWPOD-YDUSYTMISA-N |
| XLogP | 5.53 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|