C24H27N3O — CID 102475239
2-[3-[(E)-2-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 102475239) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[3-[(E)-2-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-[(E)-2-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102475239 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-[3-[(E)-2-[4-[2-(hydroxymethyl)pyrrolidin-1-yl]phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(/C=C/c2ccc(N3CCCC3CO)cc2)=CC(=C(C#N)C#N)C1 |
| InChI | InChI=1S/C24H27N3O/c1-24(2)13-19(12-20(14-24)21(15-25)16-26)6-5-18-7-9-22(10-8-18)27-11-3-4-23(27)17-28/h5-10,12,23,28H,3-4,11,13-14,17H2,1-2H3/b6-5+ |
| InChIKey | FZNRTJXMOOCOIL-AATRIKPKSA-N |
| XLogP | 4.75 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|