About 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one
4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one (PubChem CID 102475572) has the molecular formula C15H10ClN5O
and a molecular weight of 311.73 g/mol. Its IUPAC name is 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one.
Molecular Properties
| Compound Name | 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one |
| PubChem CID | 102475572 |
| Molecular Formula | C15H10ClN5O |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one |
| SMILES | O=c1c2cc(Cl)ccc2n2ncnc2n1Nc1ccccc1 |
| InChI | InChI=1S/C15H10ClN5O/c16-10-6-7-13-12(8-10)14(22)21(15-17-9-18-20(13)15)19-11-4-2-1-3-5-11/h1-9,19H |
| InChIKey | DLCUQWGAAQXXPU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one?
The IUPAC name of 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one (CID 102475572) is 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one.
What is the SMILES notation for 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one?
The canonical SMILES for 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one is O=c1c2cc(Cl)ccc2n2ncnc2n1Nc1ccccc1.
What is the InChIKey of 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one?
The InChIKey is DLCUQWGAAQXXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN5O/c16-10-6-7-13-12(8-10)14(22)21(15-17-9-18-20(13)15)19-11-4-2-1-3-5-11/h1-9,19H.
What are the key properties of 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one?
4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one has a molecular weight of 311.73 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-7-chloro-[1,2,4]triazolo[1,5-a]quinazolin-5-one is sourced from PubChem (CID 102475572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).