About 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole
9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole (PubChem CID 102475949) has the molecular formula C24H15NO2S3
and a molecular weight of 445.59 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole |
| PubChem CID | 102475949 |
| Molecular Formula | C24H15NO2S3 |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole |
| SMILES | O=S(=O)(c1ccccc1)n1c2ccccc2c2cc3cc(-c4cccs4)sc3cc21 |
| InChI | InChI=1S/C24H15NO2S3/c26-30(27,17-7-2-1-3-8-17)25-20-10-5-4-9-18(20)19-13-16-14-24(22-11-6-12-28-22)29-23(16)15-21(19)25/h1-15H |
| InChIKey | PSCPRRLHFAPCMQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole?
The IUPAC name of 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole (CID 102475949) is 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole.
What is the SMILES notation for 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole?
The canonical SMILES for 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole is O=S(=O)(c1ccccc1)n1c2ccccc2c2cc3cc(-c4cccs4)sc3cc21.
What is the InChIKey of 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole?
The InChIKey is PSCPRRLHFAPCMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15NO2S3/c26-30(27,17-7-2-1-3-8-17)25-20-10-5-4-9-18(20)19-13-16-14-24(22-11-6-12-28-22)29-23(16)15-21(19)25/h1-15H.
What are the key properties of 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole?
9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole has a molecular weight of 445.59 g/mol, XLogP of 6.97, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-2-thiophen-2-ylthieno[2,3-b]carbazole is sourced from PubChem (CID 102475949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).