C12H23BO2Si — CID 102476375
[(1E,3E)-4-(1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]-triethylsilane (PubChem CID 102476375) has the molecular formula C12H23BO2Si and a molecular weight of 238.21 g/mol. Its IUPAC name is [(1E,3E)-4-(1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]-triethylsilane.
| Compound Name | [(1E,3E)-4-(1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]-triethylsilane |
|---|---|
| PubChem CID | 102476375 |
| Molecular Formula | C12H23BO2Si |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | [(1E,3E)-4-(1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]-triethylsilane |
| SMILES | CC[Si](/C=C/C=C/B1OCCO1)(CC)CC |
| InChI | InChI=1S/C12H23BO2Si/c1-4-16(5-2,6-3)12-8-7-9-13-14-10-11-15-13/h7-9,12H,4-6,10-11H2,1-3H3/b9-7+,12-8+ |
| InChIKey | MMXGVKRLXOCZGK-BRVZEXMBSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|