C15H29BO2Si — CID 102476377
[(1E,3E)-4-(1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]-tri(propan-2-yl)silane (PubChem CID 102476377) has the molecular formula C15H29BO2Si and a molecular weight of 280.29 g/mol. Its IUPAC name is [(1E,3E)-4-(1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]-tri(propan-2-yl)silane.
| Compound Name | [(1E,3E)-4-(1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102476377 |
| Molecular Formula | C15H29BO2Si |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(1E,3E)-4-(1,3,2-dioxaborolan-2-yl)buta-1,3-dienyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](/C=C/C=C/B1OCCO1)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H29BO2Si/c1-13(2)19(14(3)4,15(5)6)12-8-7-9-16-17-10-11-18-16/h7-9,12-15H,10-11H2,1-6H3/b9-7+,12-8+ |
| InChIKey | QGPOPTNAFDZZNS-BRVZEXMBSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|