C27H29F9O11 — CID 102476411
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenoxy]oxan-2-yl]methyl acetate (PubChem CID 102476411) has the molecular formula C27H29F9O11 and a molecular weight of 700.50 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102476411 |
| Molecular Formula | C27H29F9O11 |
| Molecular Weight | 700.50 g/mol |
| Exact Mass | 700.16 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Oc2ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H29F9O11/c1-13(37)42-12-19-20(43-14(2)38)21(44-15(3)39)22(45-16(4)40)23(47-19)46-18-8-6-17(7-9-18)41-11-5-10-24(28,29)25(30,31)26(32,33)27(34,35)36/h6-9,19-23H,5,10-12H2,1-4H3/t19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | XOJTVFTVYNOHTQ-VROINQGHSA-N |
| XLogP | 4.78 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|