C20H36O3 — CID 102476471
8-[5-(8-hydroxyoctyl)furan-2-yl]octan-1-ol (PubChem CID 102476471) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is 8-[5-(8-hydroxyoctyl)furan-2-yl]octan-1-ol.
| Compound Name | 8-[5-(8-hydroxyoctyl)furan-2-yl]octan-1-ol |
|---|---|
| PubChem CID | 102476471 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 8-[5-(8-hydroxyoctyl)furan-2-yl]octan-1-ol |
| SMILES | OCCCCCCCCc1ccc(CCCCCCCCO)o1 |
| InChI | InChI=1S/C20H36O3/c21-17-11-7-3-1-5-9-13-19-15-16-20(23-19)14-10-6-2-4-8-12-18-22/h15-16,21-22H,1-14,17-18H2 |
| InChIKey | CQMKALOHKLZKPA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|