C23H30ClN — CID 10247654
(4aS,5R,9bS)-7-methyl-5-(4-methylphenyl)-2-propan-2-yl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine;hydrochloride (PubChem CID 10247654) has the molecular formula C23H30ClN and a molecular weight of 355.95 g/mol. Its IUPAC name is (4aS,5R,9bS)-7-methyl-5-(4-methylphenyl)-2-propan-2-yl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine;hydrochloride.
| Compound Name | (4aS,5R,9bS)-7-methyl-5-(4-methylphenyl)-2-propan-2-yl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 10247654 |
| Molecular Formula | C23H30ClN |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4aS,5R,9bS)-7-methyl-5-(4-methylphenyl)-2-propan-2-yl-1,3,4,4a,5,9b-hexahydroindeno[1,2-c]pyridine;hydrochloride |
| SMILES | Cc1ccc([C@@H]2c3cc(C)ccc3[C@H]3CN(C(C)C)CC[C@@H]23)cc1.Cl |
| InChI | InChI=1S/C23H29N.ClH/c1-15(2)24-12-11-20-22(14-24)19-10-7-17(4)13-21(19)23(20)18-8-5-16(3)6-9-18;/h5-10,13,15,20,22-23H,11-12,14H2,1-4H3;1H/t20-,22-,23+;/m1./s1 |
| InChIKey | NQFMHSUHRFQMEE-QKBKGCIOSA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |