C26H42N14O4 — CID 102476630
2-[6,14,17-tris(2-hydrazinyl-2-oxoethyl)-3,6,14,17,23,24-hexazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaen-3-yl]acetohydrazide (PubChem CID 102476630) has the molecular formula C26H42N14O4 and a molecular weight of 614.72 g/mol. Its IUPAC name is 2-[6,14,17-tris(2-hydrazinyl-2-oxoethyl)-3,6,14,17,23,24-hexazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaen-3-yl]acetohydrazide.
| Compound Name | 2-[6,14,17-tris(2-hydrazinyl-2-oxoethyl)-3,6,14,17,23,24-hexazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaen-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 102476630 |
| Molecular Formula | C26H42N14O4 |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | 2-[6,14,17-tris(2-hydrazinyl-2-oxoethyl)-3,6,14,17,23,24-hexazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaen-3-yl]acetohydrazide |
| SMILES | NNC(=O)CN1CCN(CC(=O)NN)Cc2cccc(n2)CN(CC(=O)NN)CCN(CC(=O)NN)Cc2cccc(n2)C1 |
| InChI | InChI=1S/C26H42N14O4/c27-33-23(41)15-37-7-9-39(17-25(43)35-29)13-21-5-2-6-22(32-21)14-40(18-26(44)36-30)10-8-38(16-24(42)34-28)12-20-4-1-3-19(11-37)31-20/h1-6H,7-18,27-30H2,(H,33,41)(H,34,42)(H,35,43)(H,36,44) |
| InChIKey | ZAVMOGJHVKLXLV-UHFFFAOYSA-N |
| XLogP | -4.64 |
| TPSA | 259.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|