C22H32O5SSi — CID 102476896
(3S,4aS,8S,8aR)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3,4,4a,7,8,8a-hexahydroisochromen-1-one (PubChem CID 102476896) has the molecular formula C22H32O5SSi and a molecular weight of 436.65 g/mol. Its IUPAC name is (3S,4aS,8S,8aR)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3,4,4a,7,8,8a-hexahydroisochromen-1-one.
| Compound Name | (3S,4aS,8S,8aR)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3,4,4a,7,8,8a-hexahydroisochromen-1-one |
|---|---|
| PubChem CID | 102476896 |
| Molecular Formula | C22H32O5SSi |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (3S,4aS,8S,8aR)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3,4,4a,7,8,8a-hexahydroisochromen-1-one |
| SMILES | C[C@H]1C[C@H]2C=C(O[Si](C)(C)C(C)(C)C)C[C@H](S(=O)(=O)c3ccccc3)[C@H]2C(=O)O1 |
| InChI | InChI=1S/C22H32O5SSi/c1-15-12-16-13-17(27-29(5,6)22(2,3)4)14-19(20(16)21(23)26-15)28(24,25)18-10-8-7-9-11-18/h7-11,13,15-16,19-20H,12,14H2,1-6H3/t15-,16-,19-,20-/m0/s1 |
| InChIKey | CDIJAMMEDAHAKE-FVCZOJIISA-N |
| XLogP | 4.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|