C24H30N2O4 — CID 102477288
(5S,6R)-4-benzyl-3-[(2S,3R)-3-hydroxy-2,4-dimethylpentanoyl]-5-methyl-6-phenyl-1,3,4-oxadiazinan-2-one (PubChem CID 102477288) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is (5S,6R)-4-benzyl-3-[(2S,3R)-3-hydroxy-2,4-dimethylpentanoyl]-5-methyl-6-phenyl-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6R)-4-benzyl-3-[(2S,3R)-3-hydroxy-2,4-dimethylpentanoyl]-5-methyl-6-phenyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 102477288 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (5S,6R)-4-benzyl-3-[(2S,3R)-3-hydroxy-2,4-dimethylpentanoyl]-5-methyl-6-phenyl-1,3,4-oxadiazinan-2-one |
| SMILES | CC(C)[C@@H](O)[C@H](C)C(=O)N1C(=O)O[C@H](c2ccccc2)[C@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H30N2O4/c1-16(2)21(27)17(3)23(28)26-24(29)30-22(20-13-9-6-10-14-20)18(4)25(26)15-19-11-7-5-8-12-19/h5-14,16-18,21-22,27H,15H2,1-4H3/t17-,18-,21+,22-/m0/s1 |
| InChIKey | RAHXPWGAPNVNKT-HXHBTQRASA-N |
| XLogP | 4.17 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |