C25H32N2O4 — CID 102477290
(5S,6R)-4-benzyl-3-[(2S,3S)-3-hydroxy-2,4,4-trimethylpentanoyl]-5-methyl-6-phenyl-1,3,4-oxadiazinan-2-one (PubChem CID 102477290) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (5S,6R)-4-benzyl-3-[(2S,3S)-3-hydroxy-2,4,4-trimethylpentanoyl]-5-methyl-6-phenyl-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6R)-4-benzyl-3-[(2S,3S)-3-hydroxy-2,4,4-trimethylpentanoyl]-5-methyl-6-phenyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 102477290 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (5S,6R)-4-benzyl-3-[(2S,3S)-3-hydroxy-2,4,4-trimethylpentanoyl]-5-methyl-6-phenyl-1,3,4-oxadiazinan-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)O[C@H](c2ccccc2)[C@H](C)N1Cc1ccccc1)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C25H32N2O4/c1-17(22(28)25(3,4)5)23(29)27-24(30)31-21(20-14-10-7-11-15-20)18(2)26(27)16-19-12-8-6-9-13-19/h6-15,17-18,21-22,28H,16H2,1-5H3/t17-,18-,21-,22-/m0/s1 |
| InChIKey | YYIKRQHAEYUOOX-GPHNJDIKSA-N |
| XLogP | 4.56 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |