C16H14N4O2S2 — CID 102477805
4,5-bis[(4-methylpyrimidin-2-yl)sulfanyl]benzene-1,2-diol (PubChem CID 102477805) has the molecular formula C16H14N4O2S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 4,5-bis[(4-methylpyrimidin-2-yl)sulfanyl]benzene-1,2-diol.
| Compound Name | 4,5-bis[(4-methylpyrimidin-2-yl)sulfanyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 102477805 |
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4,5-bis[(4-methylpyrimidin-2-yl)sulfanyl]benzene-1,2-diol |
| SMILES | Cc1ccnc(Sc2cc(O)c(O)cc2Sc2nccc(C)n2)n1 |
| InChI | InChI=1S/C16H14N4O2S2/c1-9-3-5-17-15(19-9)23-13-7-11(21)12(22)8-14(13)24-16-18-6-4-10(2)20-16/h3-8,21-22H,1-2H3 |
| InChIKey | RARBEUZZCAFUMP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|