C14H20N4O8 — CID 102477845
methyl (2R,3R,4S)-3-acetamido-2-[(1R,2R)-3-acetyloxy-1,2-dihydroxypropyl]-4-azido-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 102477845) has the molecular formula C14H20N4O8 and a molecular weight of 372.33 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-acetamido-2-[(1R,2R)-3-acetyloxy-1,2-dihydroxypropyl]-4-azido-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-3-acetamido-2-[(1R,2R)-3-acetyloxy-1,2-dihydroxypropyl]-4-azido-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 102477845 |
| Molecular Formula | C14H20N4O8 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | methyl (2R,3R,4S)-3-acetamido-2-[(1R,2R)-3-acetyloxy-1,2-dihydroxypropyl]-4-azido-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](N=[N+]=[N-])[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)COC(C)=O)O1 |
| InChI | InChI=1S/C14H20N4O8/c1-6(19)16-11-8(17-18-15)4-10(14(23)24-3)26-13(11)12(22)9(21)5-25-7(2)20/h4,8-9,11-13,21-22H,5H2,1-3H3,(H,16,19)/t8-,9+,11+,12+,13+/m0/s1 |
| InChIKey | PGIBJMSLUWJTMW-IINAIABHSA-N |
| XLogP | -1.09 |
| TPSA | 180.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|