About 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine
3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine (PubChem CID 102478187) has the molecular formula C13H14ClN7
and a molecular weight of 303.76 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine.
Molecular Properties
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine |
| PubChem CID | 102478187 |
| Molecular Formula | C13H14ClN7 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine |
| SMILES | [H]/N=c1\c2nnn(Cc3ccc(Cl)nc3)c2ncn1C(C)C |
| InChI | InChI=1S/C13H14ClN7/c1-8(2)20-7-17-13-11(12(20)15)18-19-21(13)6-9-3-4-10(14)16-5-9/h3-5,7-8,15H,6H2,1-2H3/b15-12+ |
| InChIKey | PDONMIYLCYXGIN-NTCAYCPXSA-N |
| XLogP | 1.78 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine?
The IUPAC name of 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine (CID 102478187) is 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine.
What is the SMILES notation for 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine?
The canonical SMILES for 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine is [H]/N=c1\c2nnn(Cc3ccc(Cl)nc3)c2ncn1C(C)C.
What is the InChIKey of 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine?
The InChIKey is PDONMIYLCYXGIN-NTCAYCPXSA-N. The full InChI is InChI=1S/C13H14ClN7/c1-8(2)20-7-17-13-11(12(20)15)18-19-21(13)6-9-3-4-10(14)16-5-9/h3-5,7-8,15H,6H2,1-2H3/b15-12+.
What are the key properties of 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine?
3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine has a molecular weight of 303.76 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-chloro-3-pyridinyl)methyl]-6-propan-2-yltriazolo[4,5-d]pyrimidin-7-imine is sourced from PubChem (CID 102478187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).