C18H34O3SSi — CID 10247853
(4S,6S)-7-(3,4-dihydro-2H-thiopyran-6-yl)-6-(2-trimethylsilylethoxymethoxy)hept-1-en-4-ol (PubChem CID 10247853) has the molecular formula C18H34O3SSi and a molecular weight of 358.62 g/mol. Its IUPAC name is (4S,6S)-7-(3,4-dihydro-2H-thiopyran-6-yl)-6-(2-trimethylsilylethoxymethoxy)hept-1-en-4-ol.
| Compound Name | (4S,6S)-7-(3,4-dihydro-2H-thiopyran-6-yl)-6-(2-trimethylsilylethoxymethoxy)hept-1-en-4-ol |
|---|---|
| PubChem CID | 10247853 |
| Molecular Formula | C18H34O3SSi |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (4S,6S)-7-(3,4-dihydro-2H-thiopyran-6-yl)-6-(2-trimethylsilylethoxymethoxy)hept-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@@H](CC1=CCCCS1)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C18H34O3SSi/c1-5-8-16(19)13-17(14-18-9-6-7-11-22-18)21-15-20-10-12-23(2,3)4/h5,9,16-17,19H,1,6-8,10-15H2,2-4H3/t16-,17-/m0/s1 |
| InChIKey | SAVBNRHWQGHTKC-IRXDYDNUSA-N |
| XLogP | 4.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|