C13H17ClFNO5 — CID 102478597
(1S,2R,4S,5S)-6-[(2-chloro-5-fluorophenyl)methylamino]cyclohexane-1,2,3,4,5-pentol (PubChem CID 102478597) has the molecular formula C13H17ClFNO5 and a molecular weight of 321.73 g/mol. Its IUPAC name is (1S,2R,4S,5S)-6-[(2-chloro-5-fluorophenyl)methylamino]cyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2R,4S,5S)-6-[(2-chloro-5-fluorophenyl)methylamino]cyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 102478597 |
| Molecular Formula | C13H17ClFNO5 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (1S,2R,4S,5S)-6-[(2-chloro-5-fluorophenyl)methylamino]cyclohexane-1,2,3,4,5-pentol |
| SMILES | OC1[C@@H](O)[C@@H](O)C(NCc2cc(F)ccc2Cl)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17ClFNO5/c14-7-2-1-6(15)3-5(7)4-16-8-9(17)11(19)13(21)12(20)10(8)18/h1-3,8-13,16-21H,4H2/t8?,9-,10-,11-,12+,13?/m0/s1 |
| InChIKey | VOXFYICJMVAQDQ-NIJYLJMBSA-N |
| XLogP | -1.24 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |