About [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide
[(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide (PubChem CID 102478787) has the molecular formula C29H40N6
and a molecular weight of 472.68 g/mol. Its IUPAC name is [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide.
Molecular Properties
| Compound Name | [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide |
| PubChem CID | 102478787 |
| Molecular Formula | C29H40N6 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide |
| SMILES | CCCCCCCCC1(CCCCCCCC)C2=CC(=NN=[N-])C=CC2=C2C=CC(=N[N+]#N)C=C21 |
| InChI | InChI=1S/C29H40N6/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(32-34-30)15-17-25(27)26-18-16-24(33-35-31)22-28(26)29/h15-18,21-22H,3-14,19-20H2,1-2H3 |
| InChIKey | VCIGXGOPJGGFCJ-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide?
The IUPAC name of [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide (CID 102478787) is [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide.
What is the SMILES notation for [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide?
The canonical SMILES for [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide is CCCCCCCCC1(CCCCCCCC)C2=CC(=NN=[N-])C=CC2=C2C=CC(=N[N+]#N)C=C21.
What is the InChIKey of [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide?
The InChIKey is VCIGXGOPJGGFCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H40N6/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(32-34-30)15-17-25(27)26-18-16-24(33-35-31)22-28(26)29/h15-18,21-22H,3-14,19-20H2,1-2H3.
What are the key properties of [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide?
[(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide has a molecular weight of 472.68 g/mol, XLogP of 9.36, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(7-diazonioimino-9,9-dioctylfluoren-2-ylidene)hydrazinylidene]azanide is sourced from PubChem (CID 102478787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).