About 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene
2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene (PubChem CID 102478788) has the molecular formula C29H41N6+
and a molecular weight of 473.69 g/mol. Its IUPAC name is 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene.
Molecular Properties
| Compound Name | 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene |
| PubChem CID | 102478788 |
| Molecular Formula | C29H41N6+ |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene |
| SMILES | [H]/N=N/N=C1C=CC2=C3C=CC(=N[N+]#N)C=C3C(CCCCCCCC)(CCCCCCCC)C2=C1 |
| InChI | InChI=1S/C29H41N6/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(32-34-30)15-17-25(27)26-18-16-24(33-35-31)22-28(26)29/h15-18,21-22,30H,3-14,19-20H2,1-2H3/q+1/b32-23?,33-24?,34-30+ |
| InChIKey | WWCKWXZZHVEARA-ZFKRTNBASA-N |
| XLogP | 9.37 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene?
The IUPAC name of 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene (CID 102478788) is 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene.
What is the SMILES notation for 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene?
The canonical SMILES for 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene is [H]/N=N/N=C1C=CC2=C3C=CC(=N[N+]#N)C=C3C(CCCCCCCC)(CCCCCCCC)C2=C1.
What is the InChIKey of 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene?
The InChIKey is WWCKWXZZHVEARA-ZFKRTNBASA-N. The full InChI is InChI=1S/C29H41N6/c1-3-5-7-9-11-13-19-29(20-14-12-10-8-6-4-2)27-21-23(32-34-30)15-17-25(27)26-18-16-24(33-35-31)22-28(26)29/h15-18,21-22,30H,3-14,19-20H2,1-2H3/q+1/b32-23?,33-24?,34-30+.
What are the key properties of 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene?
2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene has a molecular weight of 473.69 g/mol, XLogP of 9.37, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazonioimino-7-(iminohydrazinylidene)-9,9-dioctylfluorene is sourced from PubChem (CID 102478788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).