C23H24ClNO2S — CID 102478965
(1S,5R,6S,7R)-7-[2-(4-chlorophenyl)sulfanylphenyl]-3-prop-2-enyl-3-azabicyclo[3.2.1]octane-6-carboxylic acid (PubChem CID 102478965) has the molecular formula C23H24ClNO2S and a molecular weight of 413.97 g/mol. Its IUPAC name is (1S,5R,6S,7R)-7-[2-(4-chlorophenyl)sulfanylphenyl]-3-prop-2-enyl-3-azabicyclo[3.2.1]octane-6-carboxylic acid.
| Compound Name | (1S,5R,6S,7R)-7-[2-(4-chlorophenyl)sulfanylphenyl]-3-prop-2-enyl-3-azabicyclo[3.2.1]octane-6-carboxylic acid |
|---|---|
| PubChem CID | 102478965 |
| Molecular Formula | C23H24ClNO2S |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (1S,5R,6S,7R)-7-[2-(4-chlorophenyl)sulfanylphenyl]-3-prop-2-enyl-3-azabicyclo[3.2.1]octane-6-carboxylic acid |
| SMILES | C=CCN1C[C@@H]2C[C@H](C1)[C@@H](c1ccccc1Sc1ccc(Cl)cc1)[C@@H]2C(=O)O |
| InChI | InChI=1S/C23H24ClNO2S/c1-2-11-25-13-15-12-16(14-25)22(23(26)27)21(15)19-5-3-4-6-20(19)28-18-9-7-17(24)8-10-18/h2-10,15-16,21-22H,1,11-14H2,(H,26,27)/t15-,16+,21+,22-/m1/s1 |
| InChIKey | JYNYPDZIDMVACK-LYZACZEUSA-N |
| XLogP | 5.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|