C23H28N2O4S — CID 102479036
(3aR,8aS)-6-benzyl-1-hydroxy-8a-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8-hexahydropyrrolo[3,4-d]azepin-5-one (PubChem CID 102479036) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is (3aR,8aS)-6-benzyl-1-hydroxy-8a-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8-hexahydropyrrolo[3,4-d]azepin-5-one.
| Compound Name | (3aR,8aS)-6-benzyl-1-hydroxy-8a-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8-hexahydropyrrolo[3,4-d]azepin-5-one |
|---|---|
| PubChem CID | 102479036 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (3aR,8aS)-6-benzyl-1-hydroxy-8a-methyl-2-(4-methylphenyl)sulfonyl-1,3,3a,4,7,8-hexahydropyrrolo[3,4-d]azepin-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3CC(=O)N(Cc4ccccc4)CC[C@]3(C)C2O)cc1 |
| InChI | InChI=1S/C23H28N2O4S/c1-17-8-10-20(11-9-17)30(28,29)25-16-19-14-21(26)24(13-12-23(19,2)22(25)27)15-18-6-4-3-5-7-18/h3-11,19,22,27H,12-16H2,1-2H3/t19-,22?,23-/m0/s1 |
| InChIKey | JJMLPEOROVJKNP-LRSMGMEUSA-N |
| XLogP | 2.76 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |