C23H21BrNOP — CID 102479328
[4-bromo-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-diphenylphosphane (PubChem CID 102479328) has the molecular formula C23H21BrNOP and a molecular weight of 438.31 g/mol. Its IUPAC name is [4-bromo-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-diphenylphosphane.
| Compound Name | [4-bromo-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 102479328 |
| Molecular Formula | C23H21BrNOP |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | [4-bromo-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-diphenylphosphane |
| SMILES | CC1(C)COC(c2cc(Br)ccc2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C23H21BrNOP/c1-23(2)16-26-22(25-23)20-15-17(24)13-14-21(20)27(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15H,16H2,1-2H3 |
| InChIKey | NTZNZQKSTQOLAS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|