C33H50O4 — CID 102480393
(2R)-2-[(3R,3aR,6S,7S,9bR)-6-(3-ethoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid (PubChem CID 102480393) has the molecular formula C33H50O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is (2R)-2-[(3R,3aR,6S,7S,9bR)-6-(3-ethoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid.
| Compound Name | (2R)-2-[(3R,3aR,6S,7S,9bR)-6-(3-ethoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid |
|---|---|
| PubChem CID | 102480393 |
| Molecular Formula | C33H50O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | (2R)-2-[(3R,3aR,6S,7S,9bR)-6-(3-ethoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydrocyclopenta[a]naphthalen-3-yl]-6-methyl-5-methylideneheptanoic acid |
| SMILES | C=C(CC[C@@H](C(=O)O)[C@H]1CC[C@@]2(C)C3=CC[C@@H](C(=C)C)[C@](C)(CCC(=O)OCC)C3=CC[C@]12C)C(C)C |
| InChI | InChI=1S/C33H50O4/c1-10-37-29(34)17-18-31(7)25(22(4)5)13-14-28-27(31)16-20-32(8)26(15-19-33(28,32)9)24(30(35)36)12-11-23(6)21(2)3/h14,16,21,24-26H,4,6,10-13,15,17-20H2,1-3,5,7-9H3,(H,35,36)/t24-,25+,26-,31+,32-,33+/m1/s1 |
| InChIKey | PMJATQUJKYISSR-DBJVCEQOSA-N |
| XLogP | 8.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|