C12H18O4 — CID 102480555
(1R,4aS,5R,7R,7aR)-1-ethoxy-5-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carbaldehyde (PubChem CID 102480555) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1R,4aS,5R,7R,7aR)-1-ethoxy-5-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carbaldehyde.
| Compound Name | (1R,4aS,5R,7R,7aR)-1-ethoxy-5-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carbaldehyde |
|---|---|
| PubChem CID | 102480555 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1R,4aS,5R,7R,7aR)-1-ethoxy-5-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carbaldehyde |
| SMILES | CCO[C@@H]1OC=C(C=O)[C@@H]2[C@H]1[C@H](C)C[C@H]2O |
| InChI | InChI=1S/C12H18O4/c1-3-15-12-10-7(2)4-9(14)11(10)8(5-13)6-16-12/h5-7,9-12,14H,3-4H2,1-2H3/t7-,9-,10-,11+,12-/m1/s1 |
| InChIKey | WQULNIFIWNOOTN-BVNKDQMESA-N |
| XLogP | 1.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|