C22H46N6O4 — CID 102480878
tert-butyl (2S)-2,6-bis[[(2S)-2,6-diaminohexanoyl]amino]hexanoate (PubChem CID 102480878) has the molecular formula C22H46N6O4 and a molecular weight of 458.65 g/mol. Its IUPAC name is tert-butyl (2S)-2,6-bis[[(2S)-2,6-diaminohexanoyl]amino]hexanoate.
| Compound Name | tert-butyl (2S)-2,6-bis[[(2S)-2,6-diaminohexanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 102480878 |
| Molecular Formula | C22H46N6O4 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | tert-butyl (2S)-2,6-bis[[(2S)-2,6-diaminohexanoyl]amino]hexanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCNC(=O)[C@@H](N)CCCCN)NC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C22H46N6O4/c1-22(2,3)32-21(31)18(28-20(30)17(26)11-5-8-14-24)12-6-9-15-27-19(29)16(25)10-4-7-13-23/h16-18H,4-15,23-26H2,1-3H3,(H,27,29)(H,28,30)/t16-,17-,18-/m0/s1 |
| InChIKey | YNTLQGZNMOVSMO-BZSNNMDCSA-N |
| XLogP | 0.01 |
| TPSA | 188.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|