C19H21NO2S2 — CID 102480888
benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate (PubChem CID 102480888) has the molecular formula C19H21NO2S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate.
| Compound Name | benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 102480888 |
| Molecular Formula | C19H21NO2S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate |
| SMILES | CC1(c2ccc(NC(=O)OCc3ccccc3)cc2)SCCCS1 |
| InChI | InChI=1S/C19H21NO2S2/c1-19(23-12-5-13-24-19)16-8-10-17(11-9-16)20-18(21)22-14-15-6-3-2-4-7-15/h2-4,6-11H,5,12-14H2,1H3,(H,20,21) |
| InChIKey | CXUWHJPNRXGGQY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |