benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate

C19H21NO2S2 — CID 102480888

IUPACbenzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate
SMILESCC1(c2ccc(NC(=O)OCc3ccccc3)cc2)SCCCS1
InChIInChI=1S/C19H21NO2S2/c1-19(23-12-5-13-24-19)16-8-10-17(11-9-16)20-18(21)22-14-15-6-3-2-4-7-15/h2-4,6-11H,5,12-14H2,1H3,(H,20,21)
InChIKeyCXUWHJPNRXGGQY-UHFFFAOYSA-N
MW359.52 g/mol
LogP5.48
Rot. Bonds4

About benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate

benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate (PubChem CID 102480888) has the molecular formula C19H21NO2S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate.

Molecular Properties

Compound Namebenzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate
PubChem CID102480888
Molecular FormulaC19H21NO2S2
Molecular Weight359.52 g/mol
Exact Mass359.10
IUPAC Namebenzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate
SMILESCC1(c2ccc(NC(=O)OCc3ccccc3)cc2)SCCCS1
InChIInChI=1S/C19H21NO2S2/c1-19(23-12-5-13-24-19)16-8-10-17(11-9-16)20-18(21)22-14-15-6-3-2-4-7-15/h2-4,6-11H,5,12-14H2,1H3,(H,20,21)
InChIKeyCXUWHJPNRXGGQY-UHFFFAOYSA-N
XLogP5.48
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500359.52
LogP ≤ 55.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate?
The IUPAC name of benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate (CID 102480888) is benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate.
What is the SMILES notation for benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate?
The canonical SMILES for benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate is CC1(c2ccc(NC(=O)OCc3ccccc3)cc2)SCCCS1.
What is the InChIKey of benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate?
The InChIKey is CXUWHJPNRXGGQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO2S2/c1-19(23-12-5-13-24-19)16-8-10-17(11-9-16)20-18(21)22-14-15-6-3-2-4-7-15/h2-4,6-11H,5,12-14H2,1H3,(H,20,21).
What are the key properties of benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate?
benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate has a molecular weight of 359.52 g/mol, XLogP of 5.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[4-(2-methyl-1,3-dithian-2-yl)phenyl]carbamate is sourced from PubChem (CID 102480888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).