C23H28N2O2 — CID 102481162
N,N-diethyl-3-[(2R,4S)-1-methyl-2-phenyl-3,4-dihydro-2H-quinolin-4-yl]-2-oxopropanamide (PubChem CID 102481162) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N,N-diethyl-3-[(2R,4S)-1-methyl-2-phenyl-3,4-dihydro-2H-quinolin-4-yl]-2-oxopropanamide.
| Compound Name | N,N-diethyl-3-[(2R,4S)-1-methyl-2-phenyl-3,4-dihydro-2H-quinolin-4-yl]-2-oxopropanamide |
|---|---|
| PubChem CID | 102481162 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N,N-diethyl-3-[(2R,4S)-1-methyl-2-phenyl-3,4-dihydro-2H-quinolin-4-yl]-2-oxopropanamide |
| SMILES | CCN(CC)C(=O)C(=O)C[C@@H]1C[C@H](c2ccccc2)N(C)c2ccccc21 |
| InChI | InChI=1S/C23H28N2O2/c1-4-25(5-2)23(27)22(26)16-18-15-21(17-11-7-6-8-12-17)24(3)20-14-10-9-13-19(18)20/h6-14,18,21H,4-5,15-16H2,1-3H3/t18-,21+/m0/s1 |
| InChIKey | RCJNXQPKNJROGH-GHTZIAJQSA-N |
| XLogP | 4.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|