C12H14O6S — CID 102481269
methyl (2S,3S)-2,3-diacetyloxy-3-thiophen-2-ylpropanoate (PubChem CID 102481269) has the molecular formula C12H14O6S and a molecular weight of 286.31 g/mol. Its IUPAC name is methyl (2S,3S)-2,3-diacetyloxy-3-thiophen-2-ylpropanoate.
| Compound Name | methyl (2S,3S)-2,3-diacetyloxy-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 102481269 |
| Molecular Formula | C12H14O6S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | methyl (2S,3S)-2,3-diacetyloxy-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)c1cccs1 |
| InChI | InChI=1S/C12H14O6S/c1-7(13)17-10(9-5-4-6-19-9)11(12(15)16-3)18-8(2)14/h4-6,10-11H,1-3H3/t10-,11+/m1/s1 |
| InChIKey | BYXDZQNNGYFKAY-MNOVXSKESA-N |
| XLogP | 1.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|