About [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol
[(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol (PubChem CID 102481309) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol.
Molecular Properties
| Compound Name | [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol |
| PubChem CID | 102481309 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol |
| SMILES | C=C[C@H]1[C@H](C(O)c2ccccc2)C=CC=[N+]1[O-] |
| InChI | InChI=1S/C14H15NO2/c1-2-13-12(9-6-10-15(13)17)14(16)11-7-4-3-5-8-11/h2-10,12-14,16H,1H2/t12-,13+,14?/m1/s1 |
| InChIKey | DVIOCOGCMIESQR-AMIUJLCOSA-N |
| XLogP | 2.04 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol?
The IUPAC name of [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol (CID 102481309) is [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol.
What is the SMILES notation for [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol?
The canonical SMILES for [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol is C=C[C@H]1[C@H](C(O)c2ccccc2)C=CC=[N+]1[O-].
What is the InChIKey of [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol?
The InChIKey is DVIOCOGCMIESQR-AMIUJLCOSA-N. The full InChI is InChI=1S/C14H15NO2/c1-2-13-12(9-6-10-15(13)17)14(16)11-7-4-3-5-8-11/h2-10,12-14,16H,1H2/t12-,13+,14?/m1/s1.
What are the key properties of [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol?
[(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol has a molecular weight of 229.28 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-2-ethenyl-1-oxido-2,3-dihydropyridin-1-ium-3-yl]-phenylmethanol is sourced from PubChem (CID 102481309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).