C37H54N2O2 — CID 102481349
(4S)-4-(3,5-ditert-butylphenyl)-2-[2-[(4S)-4-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole (PubChem CID 102481349) has the molecular formula C37H54N2O2 and a molecular weight of 558.85 g/mol. Its IUPAC name is (4S)-4-(3,5-ditert-butylphenyl)-2-[2-[(4S)-4-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-(3,5-ditert-butylphenyl)-2-[2-[(4S)-4-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102481349 |
| Molecular Formula | C37H54N2O2 |
| Molecular Weight | 558.85 g/mol |
| Exact Mass | 558.42 |
| IUPAC Name | (4S)-4-(3,5-ditert-butylphenyl)-2-[2-[(4S)-4-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C1=N[C@@H](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)CO1)C1=N[C@@H](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)CO1 |
| InChI | InChI=1S/C37H54N2O2/c1-33(2,3)25-15-23(16-26(19-25)34(4,5)6)29-21-40-31(38-29)37(13,14)32-39-30(22-41-32)24-17-27(35(7,8)9)20-28(18-24)36(10,11)12/h15-20,29-30H,21-22H2,1-14H3/t29-,30-/m1/s1 |
| InChIKey | ZSKWAXQQJVVCTG-LOYHVIPDSA-N |
| XLogP | 9.54 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.85 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |