C16H21NS — CID 102481457
2'-methyl-1'-(thiophen-2-ylmethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,4'-pyrrolidine] (PubChem CID 102481457) has the molecular formula C16H21NS and a molecular weight of 259.42 g/mol. Its IUPAC name is 2'-methyl-1'-(thiophen-2-ylmethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,4'-pyrrolidine].
| Compound Name | 2'-methyl-1'-(thiophen-2-ylmethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,4'-pyrrolidine] |
|---|---|
| PubChem CID | 102481457 |
| Molecular Formula | C16H21NS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2'-methyl-1'-(thiophen-2-ylmethyl)spiro[bicyclo[2.2.1]hept-2-ene-5,4'-pyrrolidine] |
| SMILES | CC1CC2(CC3C=CC2C3)CN1Cc1cccs1 |
| InChI | InChI=1S/C16H21NS/c1-12-8-16(9-13-4-5-14(16)7-13)11-17(12)10-15-3-2-6-18-15/h2-6,12-14H,7-11H2,1H3 |
| InChIKey | VAMYSQZRLJKIEW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|