C23H25NO3 — CID 10248148
2,2-dimethyl-6-(4-phenylquinolin-2-yl)oxyhexanoic acid (PubChem CID 10248148) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-phenylquinolin-2-yl)oxyhexanoic acid.
| Compound Name | 2,2-dimethyl-6-(4-phenylquinolin-2-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 10248148 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2,2-dimethyl-6-(4-phenylquinolin-2-yl)oxyhexanoic acid |
| SMILES | CC(C)(CCCCOc1cc(-c2ccccc2)c2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C23H25NO3/c1-23(2,22(25)26)14-8-9-15-27-21-16-19(17-10-4-3-5-11-17)18-12-6-7-13-20(18)24-21/h3-7,10-13,16H,8-9,14-15H2,1-2H3,(H,25,26) |
| InChIKey | XDAFKHIHHDWBLG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|