C22H36O2Si — CID 102481518
1-[(2S,8aR,9aS)-2-[tert-butyl(dimethyl)silyl]oxy-9-methylidene-2,3,4,5,6,7,8,9a-octahydro-1H-fluoren-8a-yl]ethanone (PubChem CID 102481518) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is 1-[(2S,8aR,9aS)-2-[tert-butyl(dimethyl)silyl]oxy-9-methylidene-2,3,4,5,6,7,8,9a-octahydro-1H-fluoren-8a-yl]ethanone.
| Compound Name | 1-[(2S,8aR,9aS)-2-[tert-butyl(dimethyl)silyl]oxy-9-methylidene-2,3,4,5,6,7,8,9a-octahydro-1H-fluoren-8a-yl]ethanone |
|---|---|
| PubChem CID | 102481518 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 1-[(2S,8aR,9aS)-2-[tert-butyl(dimethyl)silyl]oxy-9-methylidene-2,3,4,5,6,7,8,9a-octahydro-1H-fluoren-8a-yl]ethanone |
| SMILES | C=C1[C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CCC2=C2CCCC[C@@]12C(C)=O |
| InChI | InChI=1S/C22H36O2Si/c1-15-19-14-17(24-25(6,7)21(3,4)5)11-12-18(19)20-10-8-9-13-22(15,20)16(2)23/h17,19H,1,8-14H2,2-7H3/t17-,19+,22-/m0/s1 |
| InChIKey | SYELNRUCHBACNG-KPLVRAHFSA-N |
| XLogP | 6.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|