About 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole
3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole (PubChem CID 102481519) has the molecular formula C24H21NO2
and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole.
Molecular Properties
| Compound Name | 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole |
| PubChem CID | 102481519 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole |
| SMILES | COc1cc(OC)c2c(c1)-c1ccccc1[C@H]2c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H21NO2/c1-14-22(18-10-6-7-11-20(18)25-14)24-17-9-5-4-8-16(17)19-12-15(26-2)13-21(27-3)23(19)24/h4-13,24-25H,1-3H3/t24-/m0/s1 |
| InChIKey | HPWFUPIZOJEPFQ-DEOSSOPVSA-N |
| XLogP | 5.65 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole?
The IUPAC name of 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole (CID 102481519) is 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole.
What is the SMILES notation for 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole?
The canonical SMILES for 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole is COc1cc(OC)c2c(c1)-c1ccccc1[C@H]2c1c(C)[nH]c2ccccc12.
What is the InChIKey of 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole?
The InChIKey is HPWFUPIZOJEPFQ-DEOSSOPVSA-N. The full InChI is InChI=1S/C24H21NO2/c1-14-22(18-10-6-7-11-20(18)25-14)24-17-9-5-4-8-16(17)19-12-15(26-2)13-21(27-3)23(19)24/h4-13,24-25H,1-3H3/t24-/m0/s1.
What are the key properties of 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole?
3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole has a molecular weight of 355.44 g/mol, XLogP of 5.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(9S)-1,3-dimethoxy-9H-fluoren-9-yl]-2-methyl-1H-indole is sourced from PubChem (CID 102481519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).