C27H24Cl3N3 — CID 102481552
2,4,6-tris(2-chloro-4,5-dimethylphenyl)-1,3,5-triazine (PubChem CID 102481552) has the molecular formula C27H24Cl3N3 and a molecular weight of 496.87 g/mol. Its IUPAC name is 2,4,6-tris(2-chloro-4,5-dimethylphenyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(2-chloro-4,5-dimethylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 102481552 |
| Molecular Formula | C27H24Cl3N3 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 2,4,6-tris(2-chloro-4,5-dimethylphenyl)-1,3,5-triazine |
| SMILES | Cc1cc(Cl)c(-c2nc(-c3cc(C)c(C)cc3Cl)nc(-c3cc(C)c(C)cc3Cl)n2)cc1C |
| InChI | InChI=1S/C27H24Cl3N3/c1-13-7-19(22(28)10-16(13)4)25-31-26(20-8-14(2)17(5)11-23(20)29)33-27(32-25)21-9-15(3)18(6)12-24(21)30/h7-12H,1-6H3 |
| InChIKey | MZZCMAQEXBNBKT-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |