About tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate
tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate (PubChem CID 10248165) has the molecular formula C19H33N5O2
and a molecular weight of 363.51 g/mol. Its IUPAC name is tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate |
| PubChem CID | 10248165 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=N\CCCCc1cnc[nH]1)NC1CCCCC1 |
| InChI | InChI=1S/C19H33N5O2/c1-19(2,3)26-18(25)24-17(23-15-9-5-4-6-10-15)21-12-8-7-11-16-13-20-14-22-16/h13-15H,4-12H2,1-3H3,(H,20,22)(H2,21,23,24,25) |
| InChIKey | YDOXMYJHEPXGAG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate?
The IUPAC name of tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate (CID 10248165) is tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate.
What is the SMILES notation for tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate?
The canonical SMILES for tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate is CC(C)(C)OC(=O)N/C(=N\CCCCc1cnc[nH]1)NC1CCCCC1.
What is the InChIKey of tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate?
The InChIKey is YDOXMYJHEPXGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N5O2/c1-19(2,3)26-18(25)24-17(23-15-9-5-4-6-10-15)21-12-8-7-11-16-13-20-14-22-16/h13-15H,4-12H2,1-3H3,(H,20,22)(H2,21,23,24,25).
What are the key properties of tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate?
tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate has a molecular weight of 363.51 g/mol, XLogP of 3.54, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[N-cyclohexyl-N'-[4-(1H-imidazol-5-yl)butyl]carbamimidoyl]carbamate is sourced from PubChem (CID 10248165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).