C23H38O2Si — CID 102481706
tert-butyl-dimethyl-[[(1S,2R,5S,6S,12S)-6,11,12-trimethyl-15-oxatetracyclo[10.2.1.01,9.02,6]pentadeca-8,10-dien-5-yl]oxy]silane (PubChem CID 102481706) has the molecular formula C23H38O2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,2R,5S,6S,12S)-6,11,12-trimethyl-15-oxatetracyclo[10.2.1.01,9.02,6]pentadeca-8,10-dien-5-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,2R,5S,6S,12S)-6,11,12-trimethyl-15-oxatetracyclo[10.2.1.01,9.02,6]pentadeca-8,10-dien-5-yl]oxy]silane |
|---|---|
| PubChem CID | 102481706 |
| Molecular Formula | C23H38O2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,2R,5S,6S,12S)-6,11,12-trimethyl-15-oxatetracyclo[10.2.1.01,9.02,6]pentadeca-8,10-dien-5-yl]oxy]silane |
| SMILES | CC1=CC2=CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]3[C@@]23CC[C@]1(C)O3 |
| InChI | InChI=1S/C23H38O2Si/c1-16-15-17-11-12-21(5)18(23(17)14-13-22(16,6)25-23)9-10-19(21)24-26(7,8)20(2,3)4/h11,15,18-19H,9-10,12-14H2,1-8H3/t18-,19+,21+,22+,23-/m1/s1 |
| InChIKey | FPPIJTJTQAYKQR-VLKNYHPOSA-N |
| XLogP | 6.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|