About (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one
(3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one (PubChem CID 102481792) has the molecular formula C17H13F3O2
and a molecular weight of 306.28 g/mol. Its IUPAC name is (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one.
Molecular Properties
| Compound Name | (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one |
| PubChem CID | 102481792 |
| Molecular Formula | C17H13F3O2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one |
| SMILES | C[C@@]1(c2ccccc2)C(=O)O[C@]1(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H13F3O2/c1-15(12-8-4-2-5-9-12)14(21)22-16(15,17(18,19)20)13-10-6-3-7-11-13/h2-11H,1H3/t15-,16+/m1/s1 |
| InChIKey | XOLZUKDUZAUKOJ-CVEARBPZSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one?
The IUPAC name of (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one (CID 102481792) is (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one.
What is the SMILES notation for (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one?
The canonical SMILES for (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one is C[C@@]1(c2ccccc2)C(=O)O[C@]1(c1ccccc1)C(F)(F)F.
What is the InChIKey of (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one?
The InChIKey is XOLZUKDUZAUKOJ-CVEARBPZSA-N. The full InChI is InChI=1S/C17H13F3O2/c1-15(12-8-4-2-5-9-12)14(21)22-16(15,17(18,19)20)13-10-6-3-7-11-13/h2-11H,1H3/t15-,16+/m1/s1.
What are the key properties of (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one?
(3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one has a molecular weight of 306.28 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-methyl-3,4-diphenyl-4-(trifluoromethyl)oxetan-2-one is sourced from PubChem (CID 102481792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).