C15H18ClNO2 — CID 102481891
(3aR,5S)-5-chloro-8-methoxy-5-methyl-3,3a,4,6-tetrahydro-2H-pyrrolo[1,2-a][1]benzazepin-1-one (PubChem CID 102481891) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is (3aR,5S)-5-chloro-8-methoxy-5-methyl-3,3a,4,6-tetrahydro-2H-pyrrolo[1,2-a][1]benzazepin-1-one.
| Compound Name | (3aR,5S)-5-chloro-8-methoxy-5-methyl-3,3a,4,6-tetrahydro-2H-pyrrolo[1,2-a][1]benzazepin-1-one |
|---|---|
| PubChem CID | 102481891 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (3aR,5S)-5-chloro-8-methoxy-5-methyl-3,3a,4,6-tetrahydro-2H-pyrrolo[1,2-a][1]benzazepin-1-one |
| SMILES | COc1ccc2c(c1)C[C@](C)(Cl)C[C@H]1CCC(=O)N21 |
| InChI | InChI=1S/C15H18ClNO2/c1-15(16)8-10-7-12(19-2)4-5-13(10)17-11(9-15)3-6-14(17)18/h4-5,7,11H,3,6,8-9H2,1-2H3/t11-,15+/m1/s1 |
| InChIKey | OATPRNOARJWALU-ABAIWWIYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|