C16H30ClNO — CID 102481944
(1S,2S,3R)-2-chloro-N,N-diethyl-3-heptyl-1-methylcyclopropane-1-carboxamide (PubChem CID 102481944) has the molecular formula C16H30ClNO and a molecular weight of 287.87 g/mol. Its IUPAC name is (1S,2S,3R)-2-chloro-N,N-diethyl-3-heptyl-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S,2S,3R)-2-chloro-N,N-diethyl-3-heptyl-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 102481944 |
| Molecular Formula | C16H30ClNO |
| Molecular Weight | 287.87 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (1S,2S,3R)-2-chloro-N,N-diethyl-3-heptyl-1-methylcyclopropane-1-carboxamide |
| SMILES | CCCCCCC[C@H]1[C@H](Cl)[C@]1(C)C(=O)N(CC)CC |
| InChI | InChI=1S/C16H30ClNO/c1-5-8-9-10-11-12-13-14(17)16(13,4)15(19)18(6-2)7-3/h13-14H,5-12H2,1-4H3/t13-,14-,16+/m0/s1 |
| InChIKey | HSWYKIIPTXRPTN-OFQRWUPVSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|