C16H22ClNO2 — CID 102481945
(1S,2S,3R)-2-chloro-N,N-diethyl-3-(4-methoxyphenyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 102481945) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is (1S,2S,3R)-2-chloro-N,N-diethyl-3-(4-methoxyphenyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S,2S,3R)-2-chloro-N,N-diethyl-3-(4-methoxyphenyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 102481945 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (1S,2S,3R)-2-chloro-N,N-diethyl-3-(4-methoxyphenyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@]1(C)[C@@H](Cl)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H22ClNO2/c1-5-18(6-2)15(19)16(3)13(14(16)17)11-7-9-12(20-4)10-8-11/h7-10,13-14H,5-6H2,1-4H3/t13-,14-,16+/m0/s1 |
| InChIKey | GRDPCURKOVYGFM-OFQRWUPVSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|