C20H28O6 — CID 10248212
[(1R,2R,3E,7S,11E,13S,15S)-2-acetyloxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] acetate (PubChem CID 10248212) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(1R,2R,3E,7S,11E,13S,15S)-2-acetyloxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] acetate.
| Compound Name | [(1R,2R,3E,7S,11E,13S,15S)-2-acetyloxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] acetate |
|---|---|
| PubChem CID | 10248212 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(1R,2R,3E,7S,11E,13S,15S)-2-acetyloxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-15-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@H](/C=C/CCC[C@H](C)OC(=O)/C=C/[C@H]2OC(C)=O)C1 |
| InChI | InChI=1S/C20H28O6/c1-13-7-5-4-6-8-16-11-17(25-14(2)21)12-18(16)19(26-15(3)22)9-10-20(23)24-13/h6,8-10,13,16-19H,4-5,7,11-12H2,1-3H3/b8-6+,10-9+/t13-,16+,17-,18+,19+/m0/s1 |
| InChIKey | ILLPGJFSCLASDH-SVJSBHBHSA-N |
| XLogP | 3.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|