C15H29N3O5 — CID 102482356
(2R)-2-[[(2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]pentanoyl]amino]propanoic acid (PubChem CID 102482356) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is (2R)-2-[[(2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]pentanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 102482356 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (2R)-2-[[(2R)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]pentanoyl]amino]propanoic acid |
| SMILES | CC(C)C[C@H](C(=O)N[C@H](C)C(=O)O)N(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29N3O5/c1-9(2)8-11(12(19)16-10(3)13(20)21)18(7)17-14(22)23-15(4,5)6/h9-11H,8H2,1-7H3,(H,16,19)(H,17,22)(H,20,21)/t10-,11-/m1/s1 |
| InChIKey | VZFUSPBCYXFZPL-GHMZBOCLSA-N |
| XLogP | 1.36 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|